C10H15FO5 — CID 10657315
[(3aS,7R,7aS)-4-fluoro-7-(methoxymethoxy)-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-yl]methanol (PubChem CID 10657315) has the molecular formula C10H15FO5 and a molecular weight of 234.22 g/mol. Its IUPAC name is [(3aS,7R,7aS)-4-fluoro-7-(methoxymethoxy)-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-yl]methanol.
| Compound Name | [(3aS,7R,7aS)-4-fluoro-7-(methoxymethoxy)-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-yl]methanol |
|---|---|
| PubChem CID | 10657315 |
| Molecular Formula | C10H15FO5 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [(3aS,7R,7aS)-4-fluoro-7-(methoxymethoxy)-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-yl]methanol |
| SMILES | COCO[C@@H]1CC(CO)=C(F)[C@H]2OCO[C@H]21 |
| InChI | InChI=1S/C10H15FO5/c1-13-4-14-7-2-6(3-12)8(11)10-9(7)15-5-16-10/h7,9-10,12H,2-5H2,1H3/t7-,9+,10-/m1/s1 |
| InChIKey | NPQQWIMGTNEVHE-FKTZTGRPSA-N |
| XLogP | 0.34 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|