C9H18ClNO5 — CID 10658704
(2S,4R,6R)-6-(hydroxymethyl)-4-(methoxymethoxy)piperidin-1-ium-2-carboxylic acid chloride (PubChem CID 10658704) has the molecular formula C9H18ClNO5 and a molecular weight of 255.70 g/mol. Its IUPAC name is (2S,4R,6R)-6-(hydroxymethyl)-4-(methoxymethoxy)piperidin-1-ium-2-carboxylic acid chloride.
| Compound Name | (2S,4R,6R)-6-(hydroxymethyl)-4-(methoxymethoxy)piperidin-1-ium-2-carboxylic acid chloride |
|---|---|
| PubChem CID | 10658704 |
| Molecular Formula | C9H18ClNO5 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (2S,4R,6R)-6-(hydroxymethyl)-4-(methoxymethoxy)piperidin-1-ium-2-carboxylic acid chloride |
| SMILES | COCO[C@@H]1C[C@H](CO)[NH2+][C@H](C(=O)O)C1.[Cl-] |
| InChI | InChI=1S/C9H17NO5.ClH/c1-14-5-15-7-2-6(4-11)10-8(3-7)9(12)13;/h6-8,10-11H,2-5H2,1H3,(H,12,13);1H/t6-,7-,8+;/m1./s1 |
| InChIKey | WBJSRDAQHVSCHO-LRACWOHVSA-N |
| XLogP | -4.85 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | -4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|