C12H20O5S — CID 135037987
methyl (1S,2R,4R)-2-ethylsulfanylcarbonyl-4-(methoxymethoxy)cyclopentane-1-carboxylate (PubChem CID 135037987) has the molecular formula C12H20O5S and a molecular weight of 276.35 g/mol. Its IUPAC name is methyl (1S,2R,4R)-2-ethylsulfanylcarbonyl-4-(methoxymethoxy)cyclopentane-1-carboxylate.
| Compound Name | methyl (1S,2R,4R)-2-ethylsulfanylcarbonyl-4-(methoxymethoxy)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 135037987 |
| Molecular Formula | C12H20O5S |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | methyl (1S,2R,4R)-2-ethylsulfanylcarbonyl-4-(methoxymethoxy)cyclopentane-1-carboxylate |
| SMILES | CCSC(=O)[C@@H]1C[C@H](OCOC)C[C@@H]1C(=O)OC |
| InChI | InChI=1S/C12H20O5S/c1-4-18-12(14)10-6-8(17-7-15-2)5-9(10)11(13)16-3/h8-10H,4-7H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | IFRUPTDDJGIZTC-KXUCPTDWSA-N |
| XLogP | 1.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|