C10H13ClN4O2S — CID 106595779
3-[(4-chloro-5-cyano-1,3-thiazol-2-yl)amino]-N-(2-methoxyethyl)propanamide (PubChem CID 106595779) has the molecular formula C10H13ClN4O2S and a molecular weight of 288.76 g/mol. Its IUPAC name is 3-[(4-chloro-5-cyano-1,3-thiazol-2-yl)amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[(4-chloro-5-cyano-1,3-thiazol-2-yl)amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 106595779 |
| Molecular Formula | C10H13ClN4O2S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 3-[(4-chloro-5-cyano-1,3-thiazol-2-yl)amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNc1nc(Cl)c(C#N)s1 |
| InChI | InChI=1S/C10H13ClN4O2S/c1-17-5-4-13-8(16)2-3-14-10-15-9(11)7(6-12)18-10/h2-5H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | ZKCLXVFBYABFCT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|