C14H22BrN3O2 — CID 106612791
4-bromo-1-ethyl-N-(2-hydroxyethyl)-N-(pyrrolidin-2-ylmethyl)pyrrole-2-carboxamide (PubChem CID 106612791) has the molecular formula C14H22BrN3O2 and a molecular weight of 344.25 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-(2-hydroxyethyl)-N-(pyrrolidin-2-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-(2-hydroxyethyl)-N-(pyrrolidin-2-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106612791 |
| Molecular Formula | C14H22BrN3O2 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-bromo-1-ethyl-N-(2-hydroxyethyl)-N-(pyrrolidin-2-ylmethyl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)N(CCO)CC1CCCN1 |
| InChI | InChI=1S/C14H22BrN3O2/c1-2-17-9-11(15)8-13(17)14(20)18(6-7-19)10-12-4-3-5-16-12/h8-9,12,16,19H,2-7,10H2,1H3 |
| InChIKey | HFIREVVCPCHWQC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |