C20H21NO4 — CID 10664808
3-(benzylamino)-6-(4-methoxyphenyl)-6-methyloxane-2,5-dione (PubChem CID 10664808) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 3-(benzylamino)-6-(4-methoxyphenyl)-6-methyloxane-2,5-dione.
| Compound Name | 3-(benzylamino)-6-(4-methoxyphenyl)-6-methyloxane-2,5-dione |
|---|---|
| PubChem CID | 10664808 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-(benzylamino)-6-(4-methoxyphenyl)-6-methyloxane-2,5-dione |
| SMILES | COc1ccc(C2(C)OC(=O)C(NCc3ccccc3)CC2=O)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-20(15-8-10-16(24-2)11-9-15)18(22)12-17(19(23)25-20)21-13-14-6-4-3-5-7-14/h3-11,17,21H,12-13H2,1-2H3 |
| InChIKey | HHAWQMLQMAAKBG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |