C17H28F3N — CID 106656962
N-[cyclohepten-1-yl-[4-(trifluoromethyl)cyclohexyl]methyl]ethanamine (PubChem CID 106656962) has the molecular formula C17H28F3N and a molecular weight of 303.41 g/mol. Its IUPAC name is N-[cyclohepten-1-yl-[4-(trifluoromethyl)cyclohexyl]methyl]ethanamine.
| Compound Name | N-[cyclohepten-1-yl-[4-(trifluoromethyl)cyclohexyl]methyl]ethanamine |
|---|---|
| PubChem CID | 106656962 |
| Molecular Formula | C17H28F3N |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-[cyclohepten-1-yl-[4-(trifluoromethyl)cyclohexyl]methyl]ethanamine |
| SMILES | CCNC(C1=CCCCCC1)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H28F3N/c1-2-21-16(13-7-5-3-4-6-8-13)14-9-11-15(12-10-14)17(18,19)20/h7,14-16,21H,2-6,8-12H2,1H3 |
| InChIKey | LZSGSUCFPHQKEC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|