C16H27F2N — CID 106657120
N-[cyclohepten-1-yl-(4,4-difluorocyclohexyl)methyl]ethanamine (PubChem CID 106657120) has the molecular formula C16H27F2N and a molecular weight of 271.39 g/mol. Its IUPAC name is N-[cyclohepten-1-yl-(4,4-difluorocyclohexyl)methyl]ethanamine.
| Compound Name | N-[cyclohepten-1-yl-(4,4-difluorocyclohexyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106657120 |
| Molecular Formula | C16H27F2N |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | N-[cyclohepten-1-yl-(4,4-difluorocyclohexyl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCCC1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H27F2N/c1-2-19-15(13-7-5-3-4-6-8-13)14-9-11-16(17,18)12-10-14/h7,14-15,19H,2-6,8-12H2,1H3 |
| InChIKey | YEIIFTUCRQWUIX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|