C17H29F2N — CID 106657174
N-[cyclohepten-1-yl-(4,4-difluorocyclohexyl)methyl]propan-1-amine (PubChem CID 106657174) has the molecular formula C17H29F2N and a molecular weight of 285.42 g/mol. Its IUPAC name is N-[cyclohepten-1-yl-(4,4-difluorocyclohexyl)methyl]propan-1-amine.
| Compound Name | N-[cyclohepten-1-yl-(4,4-difluorocyclohexyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106657174 |
| Molecular Formula | C17H29F2N |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | N-[cyclohepten-1-yl-(4,4-difluorocyclohexyl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCCCC1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C17H29F2N/c1-2-13-20-16(14-7-5-3-4-6-8-14)15-9-11-17(18,19)12-10-15/h7,15-16,20H,2-6,8-13H2,1H3 |
| InChIKey | QDUHYNYFCDDIBZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|