C11H23NO3S — CID 106666200
(3-methoxy-3-methylbutyl) (2R)-2-amino-4-methylsulfanylbutanoate (PubChem CID 106666200) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is (3-methoxy-3-methylbutyl) (2R)-2-amino-4-methylsulfanylbutanoate.
| Compound Name | (3-methoxy-3-methylbutyl) (2R)-2-amino-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 106666200 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (3-methoxy-3-methylbutyl) (2R)-2-amino-4-methylsulfanylbutanoate |
| SMILES | COC(C)(C)CCOC(=O)[C@H](N)CCSC |
| InChI | InChI=1S/C11H23NO3S/c1-11(2,14-3)6-7-15-10(13)9(12)5-8-16-4/h9H,5-8,12H2,1-4H3/t9-/m1/s1 |
| InChIKey | LVJUVAAIRGYEEF-SECBINFHSA-N |
| XLogP | 1.43 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |