C11H14O5S2 — CID 106677371
2-(2-methylsulfonylethylsulfinyl)-2-phenylacetic acid (PubChem CID 106677371) has the molecular formula C11H14O5S2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-(2-methylsulfonylethylsulfinyl)-2-phenylacetic acid.
| Compound Name | 2-(2-methylsulfonylethylsulfinyl)-2-phenylacetic acid |
|---|---|
| PubChem CID | 106677371 |
| Molecular Formula | C11H14O5S2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-(2-methylsulfonylethylsulfinyl)-2-phenylacetic acid |
| SMILES | CS(=O)(=O)CCS(=O)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H14O5S2/c1-18(15,16)8-7-17(14)10(11(12)13)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H,12,13) |
| InChIKey | ZHCFQCVLXKAARW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |