C20H26O4SSi — CID 10668156
[1-(benzenesulfonyl)-2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-dimethyl-phenylsilane (PubChem CID 10668156) has the molecular formula C20H26O4SSi and a molecular weight of 390.58 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-dimethyl-phenylsilane.
| Compound Name | [1-(benzenesulfonyl)-2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 10668156 |
| Molecular Formula | C20H26O4SSi |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [1-(benzenesulfonyl)-2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-dimethyl-phenylsilane |
| SMILES | CC1(CC([Si](C)(C)c2ccccc2)S(=O)(=O)c2ccccc2)OCCO1 |
| InChI | InChI=1S/C20H26O4SSi/c1-20(23-14-15-24-20)16-19(25(21,22)17-10-6-4-7-11-17)26(2,3)18-12-8-5-9-13-18/h4-13,19H,14-16H2,1-3H3 |
| InChIKey | LPLOQWUHSYWERU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|