C12H8Cl2F2O — CID 106689828
2-chloro-5-[1-chloro-2-(2,4-difluorophenyl)ethyl]furan (PubChem CID 106689828) has the molecular formula C12H8Cl2F2O and a molecular weight of 277.10 g/mol. Its IUPAC name is 2-chloro-5-[1-chloro-2-(2,4-difluorophenyl)ethyl]furan.
| Compound Name | 2-chloro-5-[1-chloro-2-(2,4-difluorophenyl)ethyl]furan |
|---|---|
| PubChem CID | 106689828 |
| Molecular Formula | C12H8Cl2F2O |
| Molecular Weight | 277.10 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 2-chloro-5-[1-chloro-2-(2,4-difluorophenyl)ethyl]furan |
| SMILES | Fc1ccc(CC(Cl)c2ccc(Cl)o2)c(F)c1 |
| InChI | InChI=1S/C12H8Cl2F2O/c13-9(11-3-4-12(14)17-11)5-7-1-2-8(15)6-10(7)16/h1-4,6,9H,5H2 |
| InChIKey | DMKORPXHESJDTG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.10 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|