C19H29F2O4PS — CID 10669921
(2R)-1-diethoxyphosphoryl-1,1-difluoro-6-methyl-3-(4-methylphenyl)sulfanylhept-5-en-2-ol (PubChem CID 10669921) has the molecular formula C19H29F2O4PS and a molecular weight of 422.47 g/mol. Its IUPAC name is (2R)-1-diethoxyphosphoryl-1,1-difluoro-6-methyl-3-(4-methylphenyl)sulfanylhept-5-en-2-ol.
| Compound Name | (2R)-1-diethoxyphosphoryl-1,1-difluoro-6-methyl-3-(4-methylphenyl)sulfanylhept-5-en-2-ol |
|---|---|
| PubChem CID | 10669921 |
| Molecular Formula | C19H29F2O4PS |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (2R)-1-diethoxyphosphoryl-1,1-difluoro-6-methyl-3-(4-methylphenyl)sulfanylhept-5-en-2-ol |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@@H](O)C(CC=C(C)C)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C19H29F2O4PS/c1-6-24-26(23,25-7-2)19(20,21)18(22)17(13-8-14(3)4)27-16-11-9-15(5)10-12-16/h8-12,17-18,22H,6-7,13H2,1-5H3/t17?,18-/m0/s1 |
| InChIKey | CVIOPNCTAVWJDH-ZVAWYAOSSA-N |
| XLogP | 6.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|