C15H18F3NO — CID 106702215
3-butyl-3-ethyl-7-(trifluoromethyl)-1H-indol-2-one (PubChem CID 106702215) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is 3-butyl-3-ethyl-7-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | 3-butyl-3-ethyl-7-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 106702215 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-butyl-3-ethyl-7-(trifluoromethyl)-1H-indol-2-one |
| SMILES | CCCCC1(CC)C(=O)Nc2c(C(F)(F)F)cccc21 |
| InChI | InChI=1S/C15H18F3NO/c1-3-5-9-14(4-2)10-7-6-8-11(15(16,17)18)12(10)19-13(14)20/h6-8H,3-5,9H2,1-2H3,(H,19,20) |
| InChIKey | LEWDXLIYRBCBEQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |