C13H11F3N2O4 — CID 123507982
ethyl 2-[3-hydroxy-2-oxo-7-(trifluoromethyl)-1H-indol-3-yl]-2-iminoacetate (PubChem CID 123507982) has the molecular formula C13H11F3N2O4 and a molecular weight of 316.24 g/mol. Its IUPAC name is ethyl 2-[3-hydroxy-2-oxo-7-(trifluoromethyl)-1H-indol-3-yl]-2-iminoacetate.
| Compound Name | ethyl 2-[3-hydroxy-2-oxo-7-(trifluoromethyl)-1H-indol-3-yl]-2-iminoacetate |
|---|---|
| PubChem CID | 123507982 |
| Molecular Formula | C13H11F3N2O4 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | ethyl 2-[3-hydroxy-2-oxo-7-(trifluoromethyl)-1H-indol-3-yl]-2-iminoacetate |
| SMILES | [H]/N=C(\C(=O)OCC)C1(O)C(=O)Nc2c(C(F)(F)F)cccc21 |
| InChI | InChI=1S/C13H11F3N2O4/c1-2-22-10(19)9(17)12(21)6-4-3-5-7(13(14,15)16)8(6)18-11(12)20/h3-5,17,21H,2H2,1H3,(H,18,20)/b17-9+ |
| InChIKey | KYIQBQLQBVGQMD-RQZCQDPDSA-N |
| XLogP | 1.43 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|