C26H40O4Si — CID 10670978
methyl (2Z,6E)-7,11-dimethyl-10-oxo-12-phenylmethoxy-3-(trimethylsilylmethyl)dodeca-2,6-dienoate (PubChem CID 10670978) has the molecular formula C26H40O4Si and a molecular weight of 444.69 g/mol. Its IUPAC name is methyl (2Z,6E)-7,11-dimethyl-10-oxo-12-phenylmethoxy-3-(trimethylsilylmethyl)dodeca-2,6-dienoate.
| Compound Name | methyl (2Z,6E)-7,11-dimethyl-10-oxo-12-phenylmethoxy-3-(trimethylsilylmethyl)dodeca-2,6-dienoate |
|---|---|
| PubChem CID | 10670978 |
| Molecular Formula | C26H40O4Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | methyl (2Z,6E)-7,11-dimethyl-10-oxo-12-phenylmethoxy-3-(trimethylsilylmethyl)dodeca-2,6-dienoate |
| SMILES | COC(=O)/C=C(/CC/C=C(\C)CCC(=O)C(C)COCc1ccccc1)C[Si](C)(C)C |
| InChI | InChI=1S/C26H40O4Si/c1-21(11-10-14-24(17-26(28)29-3)20-31(4,5)6)15-16-25(27)22(2)18-30-19-23-12-8-7-9-13-23/h7-9,11-13,17,22H,10,14-16,18-20H2,1-6H3/b21-11+,24-17- |
| InChIKey | CZSGXPXXOUMSGO-RZZQPQBMSA-N |
| XLogP | 6.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|