C39H46ClNO7 — CID 132570435
dimethyl (2E,6Z,9S,10Z,14E,19R)-19-chloro-11-cyano-15-methyl-18-oxo-9-phenylmethoxy-7-(phenylmethoxymethyl)icosa-2,6,10,14-tetraenedioate (PubChem CID 132570435) has the molecular formula C39H46ClNO7 and a molecular weight of 676.25 g/mol. Its IUPAC name is dimethyl (2E,6Z,9S,10Z,14E,19R)-19-chloro-11-cyano-15-methyl-18-oxo-9-phenylmethoxy-7-(phenylmethoxymethyl)icosa-2,6,10,14-tetraenedioate.
| Compound Name | dimethyl (2E,6Z,9S,10Z,14E,19R)-19-chloro-11-cyano-15-methyl-18-oxo-9-phenylmethoxy-7-(phenylmethoxymethyl)icosa-2,6,10,14-tetraenedioate |
|---|---|
| PubChem CID | 132570435 |
| Molecular Formula | C39H46ClNO7 |
| Molecular Weight | 676.25 g/mol |
| Exact Mass | 675.30 |
| IUPAC Name | dimethyl (2E,6Z,9S,10Z,14E,19R)-19-chloro-11-cyano-15-methyl-18-oxo-9-phenylmethoxy-7-(phenylmethoxymethyl)icosa-2,6,10,14-tetraenedioate |
| SMILES | COC(=O)/C=C/CC/C=C(\COCc1ccccc1)C[C@@H](/C=C(\C#N)CC/C=C(\C)CCC(=O)[C@@H](Cl)C(=O)OC)OCc1ccccc1 |
| InChI | InChI=1S/C39H46ClNO7/c1-30(22-23-36(42)38(40)39(44)46-3)14-13-20-33(26-41)24-35(48-29-32-17-9-5-10-18-32)25-34(19-11-6-12-21-37(43)45-2)28-47-27-31-15-7-4-8-16-31/h4-5,7-10,12,14-19,21,24,35,38H,6,11,13,20,22-23,25,27-29H2,1-3H3/b21-12+,30-14+,33-24-,34-19-/t35-,38-/m1/s1 |
| InChIKey | PDSLFTTZNPVOTE-GNPYAMGZSA-N |
| XLogP | 7.92 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.25 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|