C21H31N5O4S — CID 10671220
4-N,4-N-bis(2-methoxyethyl)-2-methyl-6-N-(2-methylsulfanyl-4-propan-2-ylphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 10671220) has the molecular formula C21H31N5O4S and a molecular weight of 449.58 g/mol. Its IUPAC name is 4-N,4-N-bis(2-methoxyethyl)-2-methyl-6-N-(2-methylsulfanyl-4-propan-2-ylphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-bis(2-methoxyethyl)-2-methyl-6-N-(2-methylsulfanyl-4-propan-2-ylphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 10671220 |
| Molecular Formula | C21H31N5O4S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 4-N,4-N-bis(2-methoxyethyl)-2-methyl-6-N-(2-methylsulfanyl-4-propan-2-ylphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COCCN(CCOC)c1nc(C)nc(Nc2ccc(C(C)C)cc2SC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H31N5O4S/c1-14(2)16-7-8-17(18(13-16)31-6)24-20-19(26(27)28)21(23-15(3)22-20)25(9-11-29-4)10-12-30-5/h7-8,13-14H,9-12H2,1-6H3,(H,22,23,24) |
| InChIKey | QMYCIABVQACSDB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|