C27H40O6 — CID 10671662
(E)-1-[(2R,3R)-3-[4-[(4-methoxyphenyl)methoxy]butyl]oxiran-2-yl]-6-[(4R,6S)-2,2,6-trimethyl-1,3-dioxan-4-yl]hex-2-en-1-one (PubChem CID 10671662) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is (E)-1-[(2R,3R)-3-[4-[(4-methoxyphenyl)methoxy]butyl]oxiran-2-yl]-6-[(4R,6S)-2,2,6-trimethyl-1,3-dioxan-4-yl]hex-2-en-1-one.
| Compound Name | (E)-1-[(2R,3R)-3-[4-[(4-methoxyphenyl)methoxy]butyl]oxiran-2-yl]-6-[(4R,6S)-2,2,6-trimethyl-1,3-dioxan-4-yl]hex-2-en-1-one |
|---|---|
| PubChem CID | 10671662 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | (E)-1-[(2R,3R)-3-[4-[(4-methoxyphenyl)methoxy]butyl]oxiran-2-yl]-6-[(4R,6S)-2,2,6-trimethyl-1,3-dioxan-4-yl]hex-2-en-1-one |
| SMILES | COc1ccc(COCCCC[C@H]2O[C@H]2C(=O)/C=C/CCC[C@@H]2C[C@H](C)OC(C)(C)O2)cc1 |
| InChI | InChI=1S/C27H40O6/c1-20-18-23(33-27(2,3)32-20)10-6-5-7-11-24(28)26-25(31-26)12-8-9-17-30-19-21-13-15-22(29-4)16-14-21/h7,11,13-16,20,23,25-26H,5-6,8-10,12,17-19H2,1-4H3/b11-7+/t20-,23+,25+,26-/m0/s1 |
| InChIKey | YSOKOMKLTHHFIK-WLWGMSMOSA-N |
| XLogP | 5.38 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|