C28H33FO3SSi — CID 10672902
tert-butyl-[[(2R,3S,4S)-4-fluoro-1-oxo-3-phenylmethoxythiolan-2-yl]methoxy]-diphenylsilane (PubChem CID 10672902) has the molecular formula C28H33FO3SSi and a molecular weight of 496.72 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S,4S)-4-fluoro-1-oxo-3-phenylmethoxythiolan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,3S,4S)-4-fluoro-1-oxo-3-phenylmethoxythiolan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10672902 |
| Molecular Formula | C28H33FO3SSi |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | tert-butyl-[[(2R,3S,4S)-4-fluoro-1-oxo-3-phenylmethoxythiolan-2-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1[C@@H](OCc2ccccc2)[C@H](F)CS1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33FO3SSi/c1-28(2,3)34(23-15-9-5-10-16-23,24-17-11-6-12-18-24)32-20-26-27(25(29)21-33(26)30)31-19-22-13-7-4-8-14-22/h4-18,25-27H,19-21H2,1-3H3/t25-,26-,27+,33?/m1/s1 |
| InChIKey | USFJYUVEQFIYNL-PIGRFFGMSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|