C12H24FNO2S — CID 106735889
4-(2-tert-butylsulfonylethyl)-4-fluorocyclohexan-1-amine (PubChem CID 106735889) has the molecular formula C12H24FNO2S and a molecular weight of 265.39 g/mol. Its IUPAC name is 4-(2-tert-butylsulfonylethyl)-4-fluorocyclohexan-1-amine.
| Compound Name | 4-(2-tert-butylsulfonylethyl)-4-fluorocyclohexan-1-amine |
|---|---|
| PubChem CID | 106735889 |
| Molecular Formula | C12H24FNO2S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-(2-tert-butylsulfonylethyl)-4-fluorocyclohexan-1-amine |
| SMILES | CC(C)(C)S(=O)(=O)CCC1(F)CCC(N)CC1 |
| InChI | InChI=1S/C12H24FNO2S/c1-11(2,3)17(15,16)9-8-12(13)6-4-10(14)5-7-12/h10H,4-9,14H2,1-3H3 |
| InChIKey | SCPMHDWDKLYFTP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |