C14H21BrClFN2 — CID 106762692
1-(4-bromo-3-chloro-2-fluorophenyl)-2-N,2-N-diethyl-2-methylpropane-1,2-diamine (PubChem CID 106762692) has the molecular formula C14H21BrClFN2 and a molecular weight of 351.69 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-2-N,2-N-diethyl-2-methylpropane-1,2-diamine.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-N,2-N-diethyl-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 106762692 |
| Molecular Formula | C14H21BrClFN2 |
| Molecular Weight | 351.69 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-N,2-N-diethyl-2-methylpropane-1,2-diamine |
| SMILES | CCN(CC)C(C)(C)C(N)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C14H21BrClFN2/c1-5-19(6-2)14(3,4)13(18)9-7-8-10(15)11(16)12(9)17/h7-8,13H,5-6,18H2,1-4H3 |
| InChIKey | LINRPZPHJPABHZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|