C11H16F3N5O — CID 106776218
2-[1-[[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]cyclopropyl]ethanol (PubChem CID 106776218) has the molecular formula C11H16F3N5O and a molecular weight of 291.28 g/mol. Its IUPAC name is 2-[1-[[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]cyclopropyl]ethanol.
| Compound Name | 2-[1-[[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]cyclopropyl]ethanol |
|---|---|
| PubChem CID | 106776218 |
| Molecular Formula | C11H16F3N5O |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-[1-[[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]methyl]cyclopropyl]ethanol |
| SMILES | NNc1cc(NCC2(CCO)CC2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H16F3N5O/c12-11(13,14)9-17-7(5-8(18-9)19-15)16-6-10(1-2-10)3-4-20/h5,20H,1-4,6,15H2,(H2,16,17,18,19) |
| InChIKey | SCICCJBTMOANNM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|