C7H9N5O — CID 10678910
6-imino-3,9-dimethyl-7H-purin-8-one (PubChem CID 10678910) has the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. Its IUPAC name is 6-imino-3,9-dimethyl-7H-purin-8-one.
| Compound Name | 6-imino-3,9-dimethyl-7H-purin-8-one |
|---|---|
| PubChem CID | 10678910 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 6-imino-3,9-dimethyl-7H-purin-8-one |
| SMILES | [H]/N=c1\ncn(C)c2c1[nH]c(=O)n2C |
| InChI | InChI=1S/C7H9N5O/c1-11-3-9-5(8)4-6(11)12(2)7(13)10-4/h3,8H,1-2H3,(H,10,13)/b8-5- |
| InChIKey | GVYUSYWFZHADJL-YVMONPNESA-N |
| XLogP | -0.92 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |