C10H8BrN3O — CID 106794873
6-bromo-8-but-3-ynoxyimidazo[1,2-a]pyrazine (PubChem CID 106794873) has the molecular formula C10H8BrN3O and a molecular weight of 266.10 g/mol. Its IUPAC name is 6-bromo-8-but-3-ynoxyimidazo[1,2-a]pyrazine.
| Compound Name | 6-bromo-8-but-3-ynoxyimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 106794873 |
| Molecular Formula | C10H8BrN3O |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 6-bromo-8-but-3-ynoxyimidazo[1,2-a]pyrazine |
| SMILES | C#CCCOc1nc(Br)cn2ccnc12 |
| InChI | InChI=1S/C10H8BrN3O/c1-2-3-6-15-10-9-12-4-5-14(9)7-8(11)13-10/h1,4-5,7H,3,6H2 |
| InChIKey | UNGZUSARWHVTDN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|