C13H28N2 — CID 106799729
6-(2,4-dimethylpiperidin-1-yl)hexan-3-amine (PubChem CID 106799729) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 6-(2,4-dimethylpiperidin-1-yl)hexan-3-amine.
| Compound Name | 6-(2,4-dimethylpiperidin-1-yl)hexan-3-amine |
|---|---|
| PubChem CID | 106799729 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 6-(2,4-dimethylpiperidin-1-yl)hexan-3-amine |
| SMILES | CCC(N)CCCN1CCC(C)CC1C |
| InChI | InChI=1S/C13H28N2/c1-4-13(14)6-5-8-15-9-7-11(2)10-12(15)3/h11-13H,4-10,14H2,1-3H3 |
| InChIKey | HHSNBLJKHTYZAL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |