C12H25NO — CID 62330381
5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol (PubChem CID 62330381) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol.
| Compound Name | 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol |
|---|---|
| PubChem CID | 62330381 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol |
| SMILES | CC(O)CCCN1CCC(C)CC1C |
| InChI | InChI=1S/C12H25NO/c1-10-6-8-13(11(2)9-10)7-4-5-12(3)14/h10-12,14H,4-9H2,1-3H3 |
| InChIKey | HPUNNELRIDBSGB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |