About 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol
5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol (PubChem CID 62330381) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol.
Molecular Properties
| Compound Name | 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol |
| PubChem CID | 62330381 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol |
| SMILES | CC(O)CCCN1CCC(C)CC1C |
| InChI | InChI=1S/C12H25NO/c1-10-6-8-13(11(2)9-10)7-4-5-12(3)14/h10-12,14H,4-9H2,1-3H3 |
| InChIKey | HPUNNELRIDBSGB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol?
The IUPAC name of 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol (CID 62330381) is 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol.
What is the SMILES notation for 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol?
The canonical SMILES for 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol is CC(O)CCCN1CCC(C)CC1C.
What is the InChIKey of 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol?
The InChIKey is HPUNNELRIDBSGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-10-6-8-13(11(2)9-10)7-4-5-12(3)14/h10-12,14H,4-9H2,1-3H3.
What are the key properties of 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol?
5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol has a molecular weight of 199.34 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dimethylpiperidin-1-yl)pentan-2-ol is sourced from PubChem (CID 62330381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).