C11H24N2O — CID 64787601
2-amino-4-(2,4-dimethylpiperidin-1-yl)butan-1-ol (PubChem CID 64787601) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-amino-4-(2,4-dimethylpiperidin-1-yl)butan-1-ol.
| Compound Name | 2-amino-4-(2,4-dimethylpiperidin-1-yl)butan-1-ol |
|---|---|
| PubChem CID | 64787601 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-amino-4-(2,4-dimethylpiperidin-1-yl)butan-1-ol |
| SMILES | CC1CCN(CCC(N)CO)C(C)C1 |
| InChI | InChI=1S/C11H24N2O/c1-9-3-5-13(10(2)7-9)6-4-11(12)8-14/h9-11,14H,3-8,12H2,1-2H3 |
| InChIKey | JIGNTGLNHZMTQV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |