C12H26N2 — CID 62330145
4-(2,4-dimethylpiperidin-1-yl)-N-methylbutan-2-amine (PubChem CID 62330145) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 4-(2,4-dimethylpiperidin-1-yl)-N-methylbutan-2-amine.
| Compound Name | 4-(2,4-dimethylpiperidin-1-yl)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 62330145 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 4-(2,4-dimethylpiperidin-1-yl)-N-methylbutan-2-amine |
| SMILES | CNC(C)CCN1CCC(C)CC1C |
| InChI | InChI=1S/C12H26N2/c1-10-5-7-14(12(3)9-10)8-6-11(2)13-4/h10-13H,5-9H2,1-4H3 |
| InChIKey | VMAQMPUSJXMZDT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |