C17H27N — CID 106820144
5-methyl-3-octan-2-yl-2,3-dihydro-1H-indole (PubChem CID 106820144) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 5-methyl-3-octan-2-yl-2,3-dihydro-1H-indole.
| Compound Name | 5-methyl-3-octan-2-yl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106820144 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 5-methyl-3-octan-2-yl-2,3-dihydro-1H-indole |
| SMILES | CCCCCCC(C)C1CNc2ccc(C)cc21 |
| InChI | InChI=1S/C17H27N/c1-4-5-6-7-8-14(3)16-12-18-17-10-9-13(2)11-15(16)17/h9-11,14,16,18H,4-8,12H2,1-3H3 |
| InChIKey | FQMKCMBIIAMZTE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|