C14H21N — CID 106820145
5-methyl-3-(2-methylbutan-2-yl)-2,3-dihydro-1H-indole (PubChem CID 106820145) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 5-methyl-3-(2-methylbutan-2-yl)-2,3-dihydro-1H-indole.
| Compound Name | 5-methyl-3-(2-methylbutan-2-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106820145 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 5-methyl-3-(2-methylbutan-2-yl)-2,3-dihydro-1H-indole |
| SMILES | CCC(C)(C)C1CNc2ccc(C)cc21 |
| InChI | InChI=1S/C14H21N/c1-5-14(3,4)12-9-15-13-7-6-10(2)8-11(12)13/h6-8,12,15H,5,9H2,1-4H3 |
| InChIKey | MJHJNMVDXHBIBY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |