C17H18O5 — CID 10685751
methyl (1R,4S,6R,9S)-13-acetyl-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-diene-5-carboxylate (PubChem CID 10685751) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl (1R,4S,6R,9S)-13-acetyl-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-diene-5-carboxylate.
| Compound Name | methyl (1R,4S,6R,9S)-13-acetyl-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-diene-5-carboxylate |
|---|---|
| PubChem CID | 10685751 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | methyl (1R,4S,6R,9S)-13-acetyl-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-diene-5-carboxylate |
| SMILES | COC(=O)C12[C@@H]3C=C[C@@]4(CCC[C@]5(C=C[C@H]1O5)C24C(C)=O)O3 |
| InChI | InChI=1S/C17H18O5/c1-10(18)17-14-6-3-7-15(17)9-5-12(22-15)16(17,13(19)20-2)11(21-14)4-8-14/h4-5,8-9,11-12H,3,6-7H2,1-2H3/t11-,12+,14+,15-,16?,17? |
| InChIKey | TYFHFXIHLJJNKI-MGQLETNWSA-N |
| XLogP | 1.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|