C16H22O7 — CID 10687569
methyl (1S,2S,4S)-5-(1,3-dioxolan-2-yl)-8,8-dimethoxy-2-methyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 10687569) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is methyl (1S,2S,4S)-5-(1,3-dioxolan-2-yl)-8,8-dimethoxy-2-methyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2S,4S)-5-(1,3-dioxolan-2-yl)-8,8-dimethoxy-2-methyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 10687569 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | methyl (1S,2S,4S)-5-(1,3-dioxolan-2-yl)-8,8-dimethoxy-2-methyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@H]2C(C3OCCO3)=C[C@@H]1C(=O)C2(OC)OC |
| InChI | InChI=1S/C16H22O7/c1-15(14(18)19-2)8-11-9(13-22-5-6-23-13)7-10(15)12(17)16(11,20-3)21-4/h7,10-11,13H,5-6,8H2,1-4H3/t10-,11+,15+/m1/s1 |
| InChIKey | TYMCLZZRQVEOJW-ZETOZRRWSA-N |
| XLogP | 0.67 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|