C18H9Cl2NO2 — CID 10688645
4-[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-oxochromene-3-carbonitrile (PubChem CID 10688645) has the molecular formula C18H9Cl2NO2 and a molecular weight of 342.18 g/mol. Its IUPAC name is 4-[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-oxochromene-3-carbonitrile.
| Compound Name | 4-[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-oxochromene-3-carbonitrile |
|---|---|
| PubChem CID | 10688645 |
| Molecular Formula | C18H9Cl2NO2 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 4-[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-oxochromene-3-carbonitrile |
| SMILES | N#Cc1c(/C=C/c2ccc(Cl)cc2Cl)c2ccccc2oc1=O |
| InChI | InChI=1S/C18H9Cl2NO2/c19-12-7-5-11(16(20)9-12)6-8-13-14-3-1-2-4-17(14)23-18(22)15(13)10-21/h1-9H/b8-6+ |
| InChIKey | ISIXFSUAQXULCZ-SOFGYWHQSA-N |
| XLogP | 5.14 |
| TPSA | 54.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|