C12H15Cl2N3O — CID 106890724
2-(4-amino-2,6-dichloroanilino)-1-pyrrolidin-1-ylethanone (PubChem CID 106890724) has the molecular formula C12H15Cl2N3O and a molecular weight of 288.18 g/mol. Its IUPAC name is 2-(4-amino-2,6-dichloroanilino)-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-(4-amino-2,6-dichloroanilino)-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 106890724 |
| Molecular Formula | C12H15Cl2N3O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-(4-amino-2,6-dichloroanilino)-1-pyrrolidin-1-ylethanone |
| SMILES | Nc1cc(Cl)c(NCC(=O)N2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3O/c13-9-5-8(15)6-10(14)12(9)16-7-11(18)17-3-1-2-4-17/h5-6,16H,1-4,7,15H2 |
| InChIKey | FBTGBLHZMPNCEY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|