C22H23NO3 — CID 10689151
(3R,7aR)-3-tert-butyl-6,6-diphenyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-5,7-dione (PubChem CID 10689151) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (3R,7aR)-3-tert-butyl-6,6-diphenyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-5,7-dione.
| Compound Name | (3R,7aR)-3-tert-butyl-6,6-diphenyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-5,7-dione |
|---|---|
| PubChem CID | 10689151 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (3R,7aR)-3-tert-butyl-6,6-diphenyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-5,7-dione |
| SMILES | CC(C)(C)[C@H]1OC[C@@H]2C(=O)C(c3ccccc3)(c3ccccc3)C(=O)N21 |
| InChI | InChI=1S/C22H23NO3/c1-21(2,3)20-23-17(14-26-20)18(24)22(19(23)25,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17,20H,14H2,1-3H3/t17-,20-/m1/s1 |
| InChIKey | GTNXILSMQWNXBH-YLJYHZDGSA-N |
| XLogP | 3.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|