C11H13BrCl2O2S — CID 10689844
1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene (PubChem CID 10689844) has the molecular formula C11H13BrCl2O2S and a molecular weight of 360.10 g/mol. Its IUPAC name is 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene.
| Compound Name | 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene |
|---|---|
| PubChem CID | 10689844 |
| Molecular Formula | C11H13BrCl2O2S |
| Molecular Weight | 360.10 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene |
| SMILES | O=S(=O)(CCCCCBr)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13BrCl2O2S/c12-6-2-1-3-7-17(15,16)11-5-4-9(13)8-10(11)14/h4-5,8H,1-3,6-7H2 |
| InChIKey | QMBVFTODDAMGPG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.10 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|