About 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene
1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene (PubChem CID 10689844) has the molecular formula C11H13BrCl2O2S
and a molecular weight of 360.10 g/mol. Its IUPAC name is 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene.
Molecular Properties
| Compound Name | 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene |
| PubChem CID | 10689844 |
| Molecular Formula | C11H13BrCl2O2S |
| Molecular Weight | 360.10 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene |
| SMILES | O=S(=O)(CCCCCBr)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13BrCl2O2S/c12-6-2-1-3-7-17(15,16)11-5-4-9(13)8-10(11)14/h4-5,8H,1-3,6-7H2 |
| InChIKey | QMBVFTODDAMGPG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.10 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene?
The IUPAC name of 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene (CID 10689844) is 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene.
What is the SMILES notation for 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene?
The canonical SMILES for 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene is O=S(=O)(CCCCCBr)c1ccc(Cl)cc1Cl.
What is the InChIKey of 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene?
The InChIKey is QMBVFTODDAMGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrCl2O2S/c12-6-2-1-3-7-17(15,16)11-5-4-9(13)8-10(11)14/h4-5,8H,1-3,6-7H2.
What are the key properties of 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene?
1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene has a molecular weight of 360.10 g/mol, XLogP of 4.33, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromopentylsulfonyl)-2,4-dichlorobenzene is sourced from PubChem (CID 10689844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).