C8H8Cl2N2O3S — CID 155859240
2-(2,4-dichlorophenyl)sulfonylacetohydrazide (PubChem CID 155859240) has the molecular formula C8H8Cl2N2O3S and a molecular weight of 283.14 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)sulfonylacetohydrazide.
| Compound Name | 2-(2,4-dichlorophenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 155859240 |
| Molecular Formula | C8H8Cl2N2O3S |
| Molecular Weight | 283.14 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | 2-(2,4-dichlorophenyl)sulfonylacetohydrazide |
| SMILES | NNC(=O)CS(=O)(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl2N2O3S/c9-5-1-2-7(6(10)3-5)16(14,15)4-8(13)12-11/h1-3H,4,11H2,(H,12,13) |
| InChIKey | NUYWTGMHLMBMFH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.14 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|