C19H36O7 — CID 10690944
(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-1-(2-methoxyethoxymethoxy)-2,2,6-trimethylheptan-3-one (PubChem CID 10690944) has the molecular formula C19H36O7 and a molecular weight of 376.49 g/mol. Its IUPAC name is (1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-1-(2-methoxyethoxymethoxy)-2,2,6-trimethylheptan-3-one.
| Compound Name | (1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-1-(2-methoxyethoxymethoxy)-2,2,6-trimethylheptan-3-one |
|---|---|
| PubChem CID | 10690944 |
| Molecular Formula | C19H36O7 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | (1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-1-(2-methoxyethoxymethoxy)-2,2,6-trimethylheptan-3-one |
| SMILES | COCCOCO[C@H]([C@H]1COC(C)(C)O1)C(C)(C)C(=O)CC(O)C(C)C |
| InChI | InChI=1S/C19H36O7/c1-13(2)14(20)10-16(21)18(3,4)17(24-12-23-9-8-22-7)15-11-25-19(5,6)26-15/h13-15,17,20H,8-12H2,1-7H3/t14?,15-,17-/m1/s1 |
| InChIKey | BNVKXXJSWCBRHW-HOSQGPGDSA-N |
| XLogP | 2.15 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|