C20H32N2O6 — CID 10692135
2,5-dihydroxy-1-N,4-N-bis[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]benzene-1,4-dicarboxamide (PubChem CID 10692135) has the molecular formula C20H32N2O6 and a molecular weight of 396.48 g/mol. Its IUPAC name is 2,5-dihydroxy-1-N,4-N-bis[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]benzene-1,4-dicarboxamide.
| Compound Name | 2,5-dihydroxy-1-N,4-N-bis[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 10692135 |
| Molecular Formula | C20H32N2O6 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2,5-dihydroxy-1-N,4-N-bis[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]benzene-1,4-dicarboxamide |
| SMILES | CC(C)(C)[C@@H](CO)NC(=O)c1cc(O)c(C(=O)N[C@H](CO)C(C)(C)C)cc1O |
| InChI | InChI=1S/C20H32N2O6/c1-19(2,3)15(9-23)21-17(27)11-7-14(26)12(8-13(11)25)18(28)22-16(10-24)20(4,5)6/h7-8,15-16,23-26H,9-10H2,1-6H3,(H,21,27)(H,22,28)/t15-,16-/m1/s1 |
| InChIKey | TVFMXLPCYHUGMX-HZPDHXFCSA-N |
| XLogP | 1.37 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|