C12H17ClFN3O2 — CID 166390435
4-amino-6-chloro-5-fluoro-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]pyridine-3-carboxamide (PubChem CID 166390435) has the molecular formula C12H17ClFN3O2 and a molecular weight of 289.74 g/mol. Its IUPAC name is 4-amino-6-chloro-5-fluoro-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]pyridine-3-carboxamide.
| Compound Name | 4-amino-6-chloro-5-fluoro-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166390435 |
| Molecular Formula | C12H17ClFN3O2 |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-amino-6-chloro-5-fluoro-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]pyridine-3-carboxamide |
| SMILES | CC(C)(C)[C@@H](CO)NC(=O)c1cnc(Cl)c(F)c1N |
| InChI | InChI=1S/C12H17ClFN3O2/c1-12(2,3)7(5-18)17-11(19)6-4-16-10(13)8(14)9(6)15/h4,7,18H,5H2,1-3H3,(H2,15,16)(H,17,19)/t7-/m1/s1 |
| InChIKey | IVWJSBQUCRSTFV-SSDOTTSWSA-N |
| XLogP | 1.59 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|