C21H28N2O6 — CID 10692585
ethyl (3R,4R)-5-(1-formylindol-3-yl)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 10692585) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is ethyl (3R,4R)-5-(1-formylindol-3-yl)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | ethyl (3R,4R)-5-(1-formylindol-3-yl)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 10692585 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | ethyl (3R,4R)-5-(1-formylindol-3-yl)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CCOC(=O)C[C@@H](O)[C@@H](Cc1cn(C=O)c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H28N2O6/c1-5-28-19(26)11-18(25)16(22-20(27)29-21(2,3)4)10-14-12-23(13-24)17-9-7-6-8-15(14)17/h6-9,12-13,16,18,25H,5,10-11H2,1-4H3,(H,22,27)/t16-,18-/m1/s1 |
| InChIKey | PNKOALRSKIYYNA-SJLPKXTDSA-N |
| XLogP | 2.43 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|