C30H38N2O7 — CID 10768745
[3-(3,6-dihydroxy-2,4-dimethylphenyl)-3-methylbutyl] (2S)-3-(1-formylindol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 10768745) has the molecular formula C30H38N2O7 and a molecular weight of 538.64 g/mol. Its IUPAC name is [3-(3,6-dihydroxy-2,4-dimethylphenyl)-3-methylbutyl] (2S)-3-(1-formylindol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [3-(3,6-dihydroxy-2,4-dimethylphenyl)-3-methylbutyl] (2S)-3-(1-formylindol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 10768745 |
| Molecular Formula | C30H38N2O7 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | [3-(3,6-dihydroxy-2,4-dimethylphenyl)-3-methylbutyl] (2S)-3-(1-formylindol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | Cc1cc(O)c(C(C)(C)CCOC(=O)[C@H](Cc2cn(C=O)c3ccccc23)NC(=O)OC(C)(C)C)c(C)c1O |
| InChI | InChI=1S/C30H38N2O7/c1-18-14-24(34)25(19(2)26(18)35)30(6,7)12-13-38-27(36)22(31-28(37)39-29(3,4)5)15-20-16-32(17-33)23-11-9-8-10-21(20)23/h8-11,14,16-17,22,34-35H,12-13,15H2,1-7H3,(H,31,37)/t22-/m0/s1 |
| InChIKey | YHRYYCGNFZJZFG-QFIPXVFZSA-N |
| XLogP | 5.05 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|