C28H32N2O6 — CID 155933885
methyl (2S)-3-[1-[3-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 155933885) has the molecular formula C28H32N2O6 and a molecular weight of 492.57 g/mol. Its IUPAC name is methyl (2S)-3-[1-[3-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2S)-3-[1-[3-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 155933885 |
| Molecular Formula | C28H32N2O6 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | methyl (2S)-3-[1-[3-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)/C=C/c1cccc(-n2cc(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC)c3ccccc32)c1 |
| InChI | InChI=1S/C28H32N2O6/c1-6-35-25(31)15-14-19-10-9-11-21(16-19)30-18-20(22-12-7-8-13-24(22)30)17-23(26(32)34-5)29-27(33)36-28(2,3)4/h7-16,18,23H,6,17H2,1-5H3,(H,29,33)/b15-14+/t23-/m0/s1 |
| InChIKey | LHGSXDBHNOYANN-NSFRLNINSA-N |
| XLogP | 4.82 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|