C12H15BrN2O3 — CID 106929693
5-bromo-2-(cyclopropylmethoxymethoxy)-N'-hydroxybenzenecarboximidamide (PubChem CID 106929693) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is 5-bromo-2-(cyclopropylmethoxymethoxy)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 5-bromo-2-(cyclopropylmethoxymethoxy)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 106929693 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 5-bromo-2-(cyclopropylmethoxymethoxy)-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1cc(Br)ccc1OCOCC1CC1 |
| InChI | InChI=1S/C12H15BrN2O3/c13-9-3-4-11(10(5-9)12(14)15-16)18-7-17-6-8-1-2-8/h3-5,8,16H,1-2,6-7H2,(H2,14,15) |
| InChIKey | YWJMIQWSZYUHPA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|