C20H19F3O4S — CID 10693000
(1E,4E)-4-(benzenesulfonyl)-5-ethoxy-6,6,6-trifluoro-1-phenylhexa-1,4-dien-3-ol (PubChem CID 10693000) has the molecular formula C20H19F3O4S and a molecular weight of 412.43 g/mol. Its IUPAC name is (1E,4E)-4-(benzenesulfonyl)-5-ethoxy-6,6,6-trifluoro-1-phenylhexa-1,4-dien-3-ol.
| Compound Name | (1E,4E)-4-(benzenesulfonyl)-5-ethoxy-6,6,6-trifluoro-1-phenylhexa-1,4-dien-3-ol |
|---|---|
| PubChem CID | 10693000 |
| Molecular Formula | C20H19F3O4S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | (1E,4E)-4-(benzenesulfonyl)-5-ethoxy-6,6,6-trifluoro-1-phenylhexa-1,4-dien-3-ol |
| SMILES | CCO/C(=C(\C(O)/C=C/c1ccccc1)S(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H19F3O4S/c1-2-27-19(20(21,22)23)18(28(25,26)16-11-7-4-8-12-16)17(24)14-13-15-9-5-3-6-10-15/h3-14,17,24H,2H2,1H3/b14-13+,19-18+ |
| InChIKey | IWUZFNWXRLPIAO-CDSOMVEVSA-N |
| XLogP | 4.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|