C11H13BrF2O2 — CID 106941424
3-(3-bromo-2,6-difluorophenoxy)-2,2-dimethylpropan-1-ol (PubChem CID 106941424) has the molecular formula C11H13BrF2O2 and a molecular weight of 295.12 g/mol. Its IUPAC name is 3-(3-bromo-2,6-difluorophenoxy)-2,2-dimethylpropan-1-ol.
| Compound Name | 3-(3-bromo-2,6-difluorophenoxy)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 106941424 |
| Molecular Formula | C11H13BrF2O2 |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 3-(3-bromo-2,6-difluorophenoxy)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)COc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H13BrF2O2/c1-11(2,5-15)6-16-10-8(13)4-3-7(12)9(10)14/h3-4,15H,5-6H2,1-2H3 |
| InChIKey | FBGLCYDQXWBTAV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|