C11H12BrF2NO2 — CID 174652511
(3-bromo-2,6-difluorophenyl) N-tert-butylcarbamate (PubChem CID 174652511) has the molecular formula C11H12BrF2NO2 and a molecular weight of 308.12 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl) N-tert-butylcarbamate.
| Compound Name | (3-bromo-2,6-difluorophenyl) N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174652511 |
| Molecular Formula | C11H12BrF2NO2 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl) N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H12BrF2NO2/c1-11(2,3)15-10(16)17-9-7(13)5-4-6(12)8(9)14/h4-5H,1-3H3,(H,15,16) |
| InChIKey | XDSBEJVQRDJIQD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|