C8H11F3N2O2 — CID 106952032
4-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one (PubChem CID 106952032) has the molecular formula C8H11F3N2O2 and a molecular weight of 224.18 g/mol. Its IUPAC name is 4-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one.
| Compound Name | 4-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 106952032 |
| Molecular Formula | C8H11F3N2O2 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 4-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one |
| SMILES | CC1N=C(CCOCC(F)(F)F)NC1=O |
| InChI | InChI=1S/C8H11F3N2O2/c1-5-7(14)13-6(12-5)2-3-15-4-8(9,10)11/h5H,2-4H2,1H3,(H,12,13,14) |
| InChIKey | UAARHCRRFNLYPB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|